C28H25NO6S — CID 102187974
methyl (1'S,4R,4'R,5R,6'R)-6'-(benzenesulfonyl)-4,5-diphenylspiro[1,3-dioxolane-2,5'-7-azabicyclo[2.2.1]hept-2-ene]-7'-carboxylate (PubChem CID 102187974) has the molecular formula C28H25NO6S and a molecular weight of 503.58 g/mol. Its IUPAC name is methyl (1'S,4R,4'R,5R,6'R)-6'-(benzenesulfonyl)-4,5-diphenylspiro[1,3-dioxolane-2,5'-7-azabicyclo[2.2.1]hept-2-ene]-7'-carboxylate.
| Compound Name | methyl (1'S,4R,4'R,5R,6'R)-6'-(benzenesulfonyl)-4,5-diphenylspiro[1,3-dioxolane-2,5'-7-azabicyclo[2.2.1]hept-2-ene]-7'-carboxylate |
|---|---|
| PubChem CID | 102187974 |
| Molecular Formula | C28H25NO6S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | methyl (1'S,4R,4'R,5R,6'R)-6'-(benzenesulfonyl)-4,5-diphenylspiro[1,3-dioxolane-2,5'-7-azabicyclo[2.2.1]hept-2-ene]-7'-carboxylate |
| SMILES | COC(=O)N1[C@H]2C=C[C@@H]1C1(O[C@H](c3ccccc3)[C@@H](c3ccccc3)O1)[C@@H]2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H25NO6S/c1-33-27(30)29-22-17-18-23(29)28(26(22)36(31,32)21-15-9-4-10-16-21)34-24(19-11-5-2-6-12-19)25(35-28)20-13-7-3-8-14-20/h2-18,22-26H,1H3/t22-,23+,24+,25+,26+/m0/s1 |
| InChIKey | VNOKNFWPHRBSSV-UDEADWOUSA-N |
| XLogP | 4.44 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|