C14H12N2O3 — CID 102189150
2-imino-3-(4-methoxyphenyl)-1,3-benzoxazol-5-ol (PubChem CID 102189150) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 2-imino-3-(4-methoxyphenyl)-1,3-benzoxazol-5-ol.
| Compound Name | 2-imino-3-(4-methoxyphenyl)-1,3-benzoxazol-5-ol |
|---|---|
| PubChem CID | 102189150 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-imino-3-(4-methoxyphenyl)-1,3-benzoxazol-5-ol |
| SMILES | [H]/N=c1\oc2ccc(O)cc2n1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C14H12N2O3/c1-18-11-5-2-9(3-6-11)16-12-8-10(17)4-7-13(12)19-14(16)15/h2-8,15,17H,1H3/b15-14- |
| InChIKey | NVFKNDWRDNBVKM-PFONDFGASA-N |
| XLogP | 2.42 |
| TPSA | 71.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |