C19H34ClNO3 — CID 102195813
tert-butyl N-[(4R,5S)-5-chloro-4-hydroxytetradec-2-ynyl]carbamate (PubChem CID 102195813) has the molecular formula C19H34ClNO3 and a molecular weight of 359.94 g/mol. Its IUPAC name is tert-butyl N-[(4R,5S)-5-chloro-4-hydroxytetradec-2-ynyl]carbamate.
| Compound Name | tert-butyl N-[(4R,5S)-5-chloro-4-hydroxytetradec-2-ynyl]carbamate |
|---|---|
| PubChem CID | 102195813 |
| Molecular Formula | C19H34ClNO3 |
| Molecular Weight | 359.94 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | tert-butyl N-[(4R,5S)-5-chloro-4-hydroxytetradec-2-ynyl]carbamate |
| SMILES | CCCCCCCCC[C@H](Cl)[C@H](O)C#CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H34ClNO3/c1-5-6-7-8-9-10-11-13-16(20)17(22)14-12-15-21-18(23)24-19(2,3)4/h16-17,22H,5-11,13,15H2,1-4H3,(H,21,23)/t16-,17+/m0/s1 |
| InChIKey | FMESWJXBBMMPAP-DLBZAZTESA-N |
| XLogP | 4.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.94 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|