C20H22O4 — CID 102197350
(14E)-2,5,12,17-tetraoxatricyclo[17.3.1.16,10]tetracosa-1(22),6,8,10(24),14,19(23),20-heptaene (PubChem CID 102197350) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is (14E)-2,5,12,17-tetraoxatricyclo[17.3.1.16,10]tetracosa-1(22),6,8,10(24),14,19(23),20-heptaene.
| Compound Name | (14E)-2,5,12,17-tetraoxatricyclo[17.3.1.16,10]tetracosa-1(22),6,8,10(24),14,19(23),20-heptaene |
|---|---|
| PubChem CID | 102197350 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (14E)-2,5,12,17-tetraoxatricyclo[17.3.1.16,10]tetracosa-1(22),6,8,10(24),14,19(23),20-heptaene |
| SMILES | C1=C/COCc2cccc(c2)OCCOc2cccc(c2)COC/1 |
| InChI | InChI=1S/C20H22O4/c1-2-10-22-16-18-6-4-8-20(14-18)24-12-11-23-19-7-3-5-17(13-19)15-21-9-1/h1-8,13-14H,9-12,15-16H2/b2-1+ |
| InChIKey | CRTZMONCZBAHGD-OWOJBTEDSA-N |
| XLogP | 3.75 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|