C49H20BrF10N5O2 — CID 102201220
2-[3-[5,15-bis(2,3,4,5,6-pentafluorophenyl)-22,24-dihydro-21H-corrin-10-yl]phenyl]-6-bromobenzo[de]isoquinoline-1,3-dione (PubChem CID 102201220) has the molecular formula C49H20BrF10N5O2 and a molecular weight of 980.62 g/mol. Its IUPAC name is 2-[3-[5,15-bis(2,3,4,5,6-pentafluorophenyl)-22,24-dihydro-21H-corrin-10-yl]phenyl]-6-bromobenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[3-[5,15-bis(2,3,4,5,6-pentafluorophenyl)-22,24-dihydro-21H-corrin-10-yl]phenyl]-6-bromobenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 102201220 |
| Molecular Formula | C49H20BrF10N5O2 |
| Molecular Weight | 980.62 g/mol |
| Exact Mass | 979.06 |
| IUPAC Name | 2-[3-[5,15-bis(2,3,4,5,6-pentafluorophenyl)-22,24-dihydro-21H-corrin-10-yl]phenyl]-6-bromobenzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3c(Br)ccc(c23)C(=O)N1c1cccc(-c2c3nc(c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc([nH]4)c4ccc([nH]4)c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc2[nH]4)C=C3)c1 |
| InChI | InChI=1S/C49H20BrF10N5O2/c50-23-8-7-22-33-20(23)5-2-6-21(33)48(66)65(49(22)67)19-4-1-3-18(17-19)32-26-13-15-30(63-26)34(36-38(51)42(55)46(59)43(56)39(36)52)28-11-9-24(61-28)25-10-12-29(62-25)35(31-16-14-27(32)64-31)37-40(53)44(57)47(60)45(58)41(37)54/h1-17,61-63H/b25-24-,32-26-,32-27-,34-28+,34-30+,35-29+,35-31+ |
| InChIKey | WZWMUSVOJCHYDB-RFXRFVEVSA-N |
| XLogP | 13.80 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 980.62 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|