C49H21F10N5O2 — CID 122394705
2-[3-[5,15-bis(2,3,4,5,6-pentafluorophenyl)-22,24-dihydro-21H-corrin-10-yl]phenyl]benzo[f]isoindole-1,3-dione (PubChem CID 122394705) has the molecular formula C49H21F10N5O2 and a molecular weight of 901.72 g/mol. Its IUPAC name is 2-[3-[5,15-bis(2,3,4,5,6-pentafluorophenyl)-22,24-dihydro-21H-corrin-10-yl]phenyl]benzo[f]isoindole-1,3-dione.
| Compound Name | 2-[3-[5,15-bis(2,3,4,5,6-pentafluorophenyl)-22,24-dihydro-21H-corrin-10-yl]phenyl]benzo[f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 122394705 |
| Molecular Formula | C49H21F10N5O2 |
| Molecular Weight | 901.72 g/mol |
| Exact Mass | 901.15 |
| IUPAC Name | 2-[3-[5,15-bis(2,3,4,5,6-pentafluorophenyl)-22,24-dihydro-21H-corrin-10-yl]phenyl]benzo[f]isoindole-1,3-dione |
| SMILES | O=C1c2cc3ccccc3cc2C(=O)N1c1cccc(-c2c3nc(c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc([nH]4)c4ccc([nH]4)c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc2[nH]4)C=C3)c1 |
| InChI | InChI=1S/C49H21F10N5O2/c50-38-36(39(51)43(55)46(58)42(38)54)34-29-10-8-25(60-29)26-9-11-30(61-26)35(37-40(52)44(56)47(59)45(57)41(37)53)32-15-13-28(63-32)33(27-12-14-31(34)62-27)21-6-3-7-22(16-21)64-48(65)23-17-19-4-1-2-5-20(19)18-24(23)49(64)66/h1-18,60-62H/b26-25-,33-27-,33-28-,34-29+,34-31+,35-30+,35-32+ |
| InChIKey | JJBQGDKQFAITET-CAGJYZOBSA-N |
| XLogP | 13.04 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.72 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|