C22H16BrI2NO3S — CID 102202490
5-bromo-3-(diiodomethyl)-1-(4-methylphenyl)sulfonyl-3-phenylindol-2-one (PubChem CID 102202490) has the molecular formula C22H16BrI2NO3S and a molecular weight of 708.15 g/mol. Its IUPAC name is 5-bromo-3-(diiodomethyl)-1-(4-methylphenyl)sulfonyl-3-phenylindol-2-one.
| Compound Name | 5-bromo-3-(diiodomethyl)-1-(4-methylphenyl)sulfonyl-3-phenylindol-2-one |
|---|---|
| PubChem CID | 102202490 |
| Molecular Formula | C22H16BrI2NO3S |
| Molecular Weight | 708.15 g/mol |
| Exact Mass | 706.81 |
| IUPAC Name | 5-bromo-3-(diiodomethyl)-1-(4-methylphenyl)sulfonyl-3-phenylindol-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)C(c3ccccc3)(C(I)I)c3cc(Br)ccc32)cc1 |
| InChI | InChI=1S/C22H16BrI2NO3S/c1-14-7-10-17(11-8-14)30(28,29)26-19-12-9-16(23)13-18(19)22(20(24)25,21(26)27)15-5-3-2-4-6-15/h2-13,20H,1H3 |
| InChIKey | JXLALDZERSHBKH-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.15 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|