C27H29NO3 — CID 102204103
ethyl 2-(N-ethyl-4-methoxyanilino)-4,4-diphenylbut-3-enoate (PubChem CID 102204103) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is ethyl 2-(N-ethyl-4-methoxyanilino)-4,4-diphenylbut-3-enoate.
| Compound Name | ethyl 2-(N-ethyl-4-methoxyanilino)-4,4-diphenylbut-3-enoate |
|---|---|
| PubChem CID | 102204103 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | ethyl 2-(N-ethyl-4-methoxyanilino)-4,4-diphenylbut-3-enoate |
| SMILES | CCOC(=O)C(C=C(c1ccccc1)c1ccccc1)N(CC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H29NO3/c1-4-28(23-16-18-24(30-3)19-17-23)26(27(29)31-5-2)20-25(21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-20,26H,4-5H2,1-3H3 |
| InChIKey | HFOYOKKUNFAARE-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|