C14H34F3NOSi3 — CID 102207027
2-[tert-butyl-[[tert-butyl(difluoro)silyl]amino]-[fluoro(dimethyl)silyl]oxysilyl]-2-methylpropane (PubChem CID 102207027) has the molecular formula C14H34F3NOSi3 and a molecular weight of 373.68 g/mol. Its IUPAC name is 2-[tert-butyl-[[tert-butyl(difluoro)silyl]amino]-[fluoro(dimethyl)silyl]oxysilyl]-2-methylpropane.
| Compound Name | 2-[tert-butyl-[[tert-butyl(difluoro)silyl]amino]-[fluoro(dimethyl)silyl]oxysilyl]-2-methylpropane |
|---|---|
| PubChem CID | 102207027 |
| Molecular Formula | C14H34F3NOSi3 |
| Molecular Weight | 373.68 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-[tert-butyl-[[tert-butyl(difluoro)silyl]amino]-[fluoro(dimethyl)silyl]oxysilyl]-2-methylpropane |
| SMILES | CC(C)(C)[Si](F)(F)N[Si](O[Si](C)(C)F)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H34F3NOSi3/c1-12(2,3)21(13(4,5)6,19-20(10,11)15)18-22(16,17)14(7,8)9/h18H,1-11H3 |
| InChIKey | ILSRONQGUBXZDD-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.68 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|