C12H34FN3Si3 — CID 12605458
N-[fluoro-bis[methyl(trimethylsilyl)amino]silyl]-2-methylpropan-2-amine (PubChem CID 12605458) has the molecular formula C12H34FN3Si3 and a molecular weight of 323.68 g/mol. Its IUPAC name is N-[fluoro-bis[methyl(trimethylsilyl)amino]silyl]-2-methylpropan-2-amine.
| Compound Name | N-[fluoro-bis[methyl(trimethylsilyl)amino]silyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 12605458 |
| Molecular Formula | C12H34FN3Si3 |
| Molecular Weight | 323.68 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | N-[fluoro-bis[methyl(trimethylsilyl)amino]silyl]-2-methylpropan-2-amine |
| SMILES | CN([Si](C)(C)C)[Si](F)(NC(C)(C)C)N(C)[Si](C)(C)C |
| InChI | InChI=1S/C12H34FN3Si3/c1-12(2,3)14-19(13,15(4)17(6,7)8)16(5)18(9,10)11/h14H,1-11H3 |
| InChIKey | QYSLCLHMKIQAJC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.68 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|