C13H13F18NO3Si — CID 166567858
2-methyl-N-[tris(1,1,1,3,3,3-hexafluoropropan-2-yloxy)silyl]propan-2-amine (PubChem CID 166567858) has the molecular formula C13H13F18NO3Si and a molecular weight of 601.30 g/mol. Its IUPAC name is 2-methyl-N-[tris(1,1,1,3,3,3-hexafluoropropan-2-yloxy)silyl]propan-2-amine.
| Compound Name | 2-methyl-N-[tris(1,1,1,3,3,3-hexafluoropropan-2-yloxy)silyl]propan-2-amine |
|---|---|
| PubChem CID | 166567858 |
| Molecular Formula | C13H13F18NO3Si |
| Molecular Weight | 601.30 g/mol |
| Exact Mass | 601.04 |
| IUPAC Name | 2-methyl-N-[tris(1,1,1,3,3,3-hexafluoropropan-2-yloxy)silyl]propan-2-amine |
| SMILES | CC(C)(C)N[Si](OC(C(F)(F)F)C(F)(F)F)(OC(C(F)(F)F)C(F)(F)F)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H13F18NO3Si/c1-7(2,3)32-36(33-4(8(14,15)16)9(17,18)19,34-5(10(20,21)22)11(23,24)25)35-6(12(26,27)28)13(29,30)31/h4-6,32H,1-3H3 |
| InChIKey | ATCJSAGBNDGAGY-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.30 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|