C12H18F6NO6P — CID 23628881
(Z)-N-tert-butyl-2-dimethoxyphosphoryl-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-hydroxyprop-2-enamide (PubChem CID 23628881) has the molecular formula C12H18F6NO6P and a molecular weight of 417.24 g/mol. Its IUPAC name is (Z)-N-tert-butyl-2-dimethoxyphosphoryl-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-hydroxyprop-2-enamide.
| Compound Name | (Z)-N-tert-butyl-2-dimethoxyphosphoryl-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 23628881 |
| Molecular Formula | C12H18F6NO6P |
| Molecular Weight | 417.24 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | (Z)-N-tert-butyl-2-dimethoxyphosphoryl-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-hydroxyprop-2-enamide |
| SMILES | COP(=O)(OC)/C(C(=O)NC(C)(C)C)=C(/O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H18F6NO6P/c1-10(2,3)19-7(20)6(26(22,23-4)24-5)8(21)25-9(11(13,14)15)12(16,17)18/h9,21H,1-5H3,(H,19,20)/b8-6- |
| InChIKey | ZLTFOVKONNPEAR-VURMDHGXSA-N |
| XLogP | 3.62 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.24 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|