C16H19FN2O6 — CID 102211135
1-[4-[(2R,3S,4R,5R)-5-[(4-fluorophenoxy)methyl]-3,4-dihydroxyoxolan-2-yl]but-3-ynyl]-1-hydroxyurea (PubChem CID 102211135) has the molecular formula C16H19FN2O6 and a molecular weight of 354.33 g/mol. Its IUPAC name is 1-[4-[(2R,3S,4R,5R)-5-[(4-fluorophenoxy)methyl]-3,4-dihydroxyoxolan-2-yl]but-3-ynyl]-1-hydroxyurea.
| Compound Name | 1-[4-[(2R,3S,4R,5R)-5-[(4-fluorophenoxy)methyl]-3,4-dihydroxyoxolan-2-yl]but-3-ynyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 102211135 |
| Molecular Formula | C16H19FN2O6 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-[4-[(2R,3S,4R,5R)-5-[(4-fluorophenoxy)methyl]-3,4-dihydroxyoxolan-2-yl]but-3-ynyl]-1-hydroxyurea |
| SMILES | NC(=O)N(O)CCC#C[C@H]1O[C@H](COc2ccc(F)cc2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H19FN2O6/c17-10-4-6-11(7-5-10)24-9-13-15(21)14(20)12(25-13)3-1-2-8-19(23)16(18)22/h4-7,12-15,20-21,23H,2,8-9H2,(H2,18,22)/t12-,13-,14-,15+/m1/s1 |
| InChIKey | RQAIWVQODYHSRF-TUVASFSCSA-N |
| XLogP | -0.14 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|