C17H20FNO4 — CID 59882691
N-[4-[(2S,5S)-5-[(4-fluorophenoxy)methyl]oxolan-2-yl]but-3-ynyl]-N-hydroxyacetamide (PubChem CID 59882691) has the molecular formula C17H20FNO4 and a molecular weight of 321.35 g/mol. Its IUPAC name is N-[4-[(2S,5S)-5-[(4-fluorophenoxy)methyl]oxolan-2-yl]but-3-ynyl]-N-hydroxyacetamide.
| Compound Name | N-[4-[(2S,5S)-5-[(4-fluorophenoxy)methyl]oxolan-2-yl]but-3-ynyl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 59882691 |
| Molecular Formula | C17H20FNO4 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | N-[4-[(2S,5S)-5-[(4-fluorophenoxy)methyl]oxolan-2-yl]but-3-ynyl]-N-hydroxyacetamide |
| SMILES | CC(=O)N(O)CCC#C[C@@H]1CC[C@@H](COc2ccc(F)cc2)O1 |
| InChI | InChI=1S/C17H20FNO4/c1-13(20)19(21)11-3-2-4-16-9-10-17(23-16)12-22-15-7-5-14(18)6-8-15/h5-8,16-17,21H,3,9-12H2,1H3/t16-,17+/m1/s1 |
| InChIKey | JUQOHKVGMIXEPU-SJORKVTESA-N |
| XLogP | 2.38 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|