C30H28FNO7 — CID 20588443
[4-[(2S,6S)-6-[(4-fluorophenoxy)methyl]oxan-2-yl]but-3-ynyl-phenoxycarbonylamino] phenyl carbonate (PubChem CID 20588443) has the molecular formula C30H28FNO7 and a molecular weight of 533.55 g/mol. Its IUPAC name is [4-[(2S,6S)-6-[(4-fluorophenoxy)methyl]oxan-2-yl]but-3-ynyl-phenoxycarbonylamino] phenyl carbonate.
| Compound Name | [4-[(2S,6S)-6-[(4-fluorophenoxy)methyl]oxan-2-yl]but-3-ynyl-phenoxycarbonylamino] phenyl carbonate |
|---|---|
| PubChem CID | 20588443 |
| Molecular Formula | C30H28FNO7 |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | [4-[(2S,6S)-6-[(4-fluorophenoxy)methyl]oxan-2-yl]but-3-ynyl-phenoxycarbonylamino] phenyl carbonate |
| SMILES | O=C(Oc1ccccc1)ON(CCC#C[C@@H]1CCC[C@@H](COc2ccc(F)cc2)O1)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C30H28FNO7/c31-23-17-19-24(20-18-23)35-22-28-16-9-15-25(36-28)14-7-8-21-32(29(33)37-26-10-3-1-4-11-26)39-30(34)38-27-12-5-2-6-13-27/h1-6,10-13,17-20,25,28H,8-9,15-16,21-22H2/t25-,28+/m1/s1 |
| InChIKey | BIWHRXRRBMUOSW-NAKRPHOHSA-N |
| XLogP | 6.17 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|