C13H15FO3S — CID 57173453
S-[(3R,5S)-5-[(4-fluorophenoxy)methyl]oxolan-3-yl] ethanethioate (PubChem CID 57173453) has the molecular formula C13H15FO3S and a molecular weight of 270.32 g/mol. Its IUPAC name is S-[(3R,5S)-5-[(4-fluorophenoxy)methyl]oxolan-3-yl] ethanethioate.
| Compound Name | S-[(3R,5S)-5-[(4-fluorophenoxy)methyl]oxolan-3-yl] ethanethioate |
|---|---|
| PubChem CID | 57173453 |
| Molecular Formula | C13H15FO3S |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | S-[(3R,5S)-5-[(4-fluorophenoxy)methyl]oxolan-3-yl] ethanethioate |
| SMILES | CC(=O)S[C@H]1CO[C@H](COc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C13H15FO3S/c1-9(15)18-13-6-12(17-8-13)7-16-11-4-2-10(14)3-5-11/h2-5,12-13H,6-8H2,1H3/t12-,13+/m0/s1 |
| InChIKey | CCVJFLRAGJMTKZ-QWHCGFSZSA-N |
| XLogP | 2.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|