C14H15FO5 — CID 11482939
ethyl (5S)-5-[(4-fluorophenoxy)methyl]-2-oxooxolane-3-carboxylate (PubChem CID 11482939) has the molecular formula C14H15FO5 and a molecular weight of 282.27 g/mol. Its IUPAC name is ethyl (5S)-5-[(4-fluorophenoxy)methyl]-2-oxooxolane-3-carboxylate.
| Compound Name | ethyl (5S)-5-[(4-fluorophenoxy)methyl]-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 11482939 |
| Molecular Formula | C14H15FO5 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | ethyl (5S)-5-[(4-fluorophenoxy)methyl]-2-oxooxolane-3-carboxylate |
| SMILES | CCOC(=O)C1C[C@@H](COc2ccc(F)cc2)OC1=O |
| InChI | InChI=1S/C14H15FO5/c1-2-18-13(16)12-7-11(20-14(12)17)8-19-10-5-3-9(15)4-6-10/h3-6,11-12H,2,7-8H2,1H3/t11-,12?/m0/s1 |
| InChIKey | JLNDDELBJHDXMH-PXYINDEMSA-N |
| XLogP | 1.70 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|