C17H18O3S — CID 57245485
S-[(3R,5S)-5-(naphthalen-2-yloxymethyl)oxolan-3-yl] ethanethioate (PubChem CID 57245485) has the molecular formula C17H18O3S and a molecular weight of 302.39 g/mol. Its IUPAC name is S-[(3R,5S)-5-(naphthalen-2-yloxymethyl)oxolan-3-yl] ethanethioate.
| Compound Name | S-[(3R,5S)-5-(naphthalen-2-yloxymethyl)oxolan-3-yl] ethanethioate |
|---|---|
| PubChem CID | 57245485 |
| Molecular Formula | C17H18O3S |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | S-[(3R,5S)-5-(naphthalen-2-yloxymethyl)oxolan-3-yl] ethanethioate |
| SMILES | CC(=O)S[C@H]1CO[C@H](COc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C17H18O3S/c1-12(18)21-17-9-16(20-11-17)10-19-15-7-6-13-4-2-3-5-14(13)8-15/h2-8,16-17H,9-11H2,1H3/t16-,17+/m0/s1 |
| InChIKey | QUPGCOHREWAFAZ-DLBZAZTESA-N |
| XLogP | 3.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|