C16H12F3NO4S — CID 102213867
3-[3-methyl-1-(trifluoromethylsulfonyl)-4H-pyridin-4-yl]cyclohepta[b]furan-2-one (PubChem CID 102213867) has the molecular formula C16H12F3NO4S and a molecular weight of 371.34 g/mol. Its IUPAC name is 3-[3-methyl-1-(trifluoromethylsulfonyl)-4H-pyridin-4-yl]cyclohepta[b]furan-2-one.
| Compound Name | 3-[3-methyl-1-(trifluoromethylsulfonyl)-4H-pyridin-4-yl]cyclohepta[b]furan-2-one |
|---|---|
| PubChem CID | 102213867 |
| Molecular Formula | C16H12F3NO4S |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 3-[3-methyl-1-(trifluoromethylsulfonyl)-4H-pyridin-4-yl]cyclohepta[b]furan-2-one |
| SMILES | CC1=CN(S(=O)(=O)C(F)(F)F)C=CC1c1c2cccccc-2oc1=O |
| InChI | InChI=1S/C16H12F3NO4S/c1-10-9-20(25(22,23)16(17,18)19)8-7-11(10)14-12-5-3-2-4-6-13(12)24-15(14)21/h2-9,11H,1H3 |
| InChIKey | OMUDYAIAWJHDEH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |