C13H9F3N4O4S — CID 122395379
2-[2-[4-(trifluoromethylsulfonyl)triazol-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 122395379) has the molecular formula C13H9F3N4O4S and a molecular weight of 374.30 g/mol. Its IUPAC name is 2-[2-[4-(trifluoromethylsulfonyl)triazol-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-(trifluoromethylsulfonyl)triazol-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 122395379 |
| Molecular Formula | C13H9F3N4O4S |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 2-[2-[4-(trifluoromethylsulfonyl)triazol-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCn1cc(S(=O)(=O)C(F)(F)F)nn1 |
| InChI | InChI=1S/C13H9F3N4O4S/c14-13(15,16)25(23,24)10-7-19(18-17-10)5-6-20-11(21)8-3-1-2-4-9(8)12(20)22/h1-4,7H,5-6H2 |
| InChIKey | MSUFQJFKHNUDMT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 102.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|