C9H11IO3 — CID 102214036
(1S,5S,8R)-8-iodo-1,5-dimethyl-6-oxabicyclo[3.2.1]octane-2,7-dione (PubChem CID 102214036) has the molecular formula C9H11IO3 and a molecular weight of 294.09 g/mol. Its IUPAC name is (1S,5S,8R)-8-iodo-1,5-dimethyl-6-oxabicyclo[3.2.1]octane-2,7-dione.
| Compound Name | (1S,5S,8R)-8-iodo-1,5-dimethyl-6-oxabicyclo[3.2.1]octane-2,7-dione |
|---|---|
| PubChem CID | 102214036 |
| Molecular Formula | C9H11IO3 |
| Molecular Weight | 294.09 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | (1S,5S,8R)-8-iodo-1,5-dimethyl-6-oxabicyclo[3.2.1]octane-2,7-dione |
| SMILES | C[C@]12C(=O)CC[C@](C)(OC1=O)[C@@H]2I |
| InChI | InChI=1S/C9H11IO3/c1-8-4-3-5(11)9(2,6(8)10)7(12)13-8/h6H,3-4H2,1-2H3/t6-,8-,9+/m0/s1 |
| InChIKey | SQIBSSZGTMEXKI-CNUIFLNQSA-N |
| XLogP | 1.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.09 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|