(3E)-3,4,5-trimethylhexa-3,5-dienoic acid

C9H14O2 — CID 102218972

IUPAC(3E)-3,4,5-trimethylhexa-3,5-dienoic acid
SMILESC=C(C)/C(C)=C(\C)CC(=O)O
InChIInChI=1S/C9H14O2/c1-6(2)8(4)7(3)5-9(10)11/h1,5H2,2-4H3,(H,10,11)/b8-7+
InChIKeyMYHAWVYLAOKUKM-BQYQJAHWSA-N
MW154.21 g/mol
LogP2.37
Rot. Bonds3

About (3E)-3,4,5-trimethylhexa-3,5-dienoic acid

(3E)-3,4,5-trimethylhexa-3,5-dienoic acid (PubChem CID 102218972) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (3E)-3,4,5-trimethylhexa-3,5-dienoic acid.

Molecular Properties

Compound Name(3E)-3,4,5-trimethylhexa-3,5-dienoic acid
PubChem CID102218972
Molecular FormulaC9H14O2
Molecular Weight154.21 g/mol
Exact Mass154.10
IUPAC Name(3E)-3,4,5-trimethylhexa-3,5-dienoic acid
SMILESC=C(C)/C(C)=C(\C)CC(=O)O
InChIInChI=1S/C9H14O2/c1-6(2)8(4)7(3)5-9(10)11/h1,5H2,2-4H3,(H,10,11)/b8-7+
InChIKeyMYHAWVYLAOKUKM-BQYQJAHWSA-N
XLogP2.37
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.21
LogP ≤ 52.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (3E)-3,4,5-trimethylhexa-3,5-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3E)-3,4,5-trimethylhexa-3,5-dienoic acid?
The IUPAC name of (3E)-3,4,5-trimethylhexa-3,5-dienoic acid (CID 102218972) is (3E)-3,4,5-trimethylhexa-3,5-dienoic acid.
What is the SMILES notation for (3E)-3,4,5-trimethylhexa-3,5-dienoic acid?
The canonical SMILES for (3E)-3,4,5-trimethylhexa-3,5-dienoic acid is C=C(C)/C(C)=C(\C)CC(=O)O.
What is the InChIKey of (3E)-3,4,5-trimethylhexa-3,5-dienoic acid?
The InChIKey is MYHAWVYLAOKUKM-BQYQJAHWSA-N. The full InChI is InChI=1S/C9H14O2/c1-6(2)8(4)7(3)5-9(10)11/h1,5H2,2-4H3,(H,10,11)/b8-7+.
What are the key properties of (3E)-3,4,5-trimethylhexa-3,5-dienoic acid?
(3E)-3,4,5-trimethylhexa-3,5-dienoic acid has a molecular weight of 154.21 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3,4,5-trimethylhexa-3,5-dienoic acid is sourced from PubChem (CID 102218972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).