About 9-(methoxymethyl)purine
9-(methoxymethyl)purine (PubChem CID 102219133) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is 9-(methoxymethyl)purine.
Molecular Properties
| Compound Name | 9-(methoxymethyl)purine |
| PubChem CID | 102219133 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 9-(methoxymethyl)purine |
| SMILES | COCn1cnc2cncnc21 |
| InChI | InChI=1S/C7H8N4O/c1-12-5-11-4-10-6-2-8-3-9-7(6)11/h2-4H,5H2,1H3 |
| InChIKey | KYFRKKPRYHWXGT-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-(methoxymethyl)purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(methoxymethyl)purine?
The IUPAC name of 9-(methoxymethyl)purine (CID 102219133) is 9-(methoxymethyl)purine.
What is the SMILES notation for 9-(methoxymethyl)purine?
The canonical SMILES for 9-(methoxymethyl)purine is COCn1cnc2cncnc21.
What is the InChIKey of 9-(methoxymethyl)purine?
The InChIKey is KYFRKKPRYHWXGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O/c1-12-5-11-4-10-6-2-8-3-9-7(6)11/h2-4H,5H2,1H3.
What are the key properties of 9-(methoxymethyl)purine?
9-(methoxymethyl)purine has a molecular weight of 164.17 g/mol, XLogP of 0.43, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(methoxymethyl)purine is sourced from PubChem (CID 102219133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).