C27H30ClNO11 — CID 102228350
[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl (2S)-2-[[(3R)-5-chloro-8-hydroxy-3-methyl-1-oxo-3,4-dihydroisochromene-7-carbonyl]amino]-3-phenylpropanoate (PubChem CID 102228350) has the molecular formula C27H30ClNO11 and a molecular weight of 579.99 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl (2S)-2-[[(3R)-5-chloro-8-hydroxy-3-methyl-1-oxo-3,4-dihydroisochromene-7-carbonyl]amino]-3-phenylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl (2S)-2-[[(3R)-5-chloro-8-hydroxy-3-methyl-1-oxo-3,4-dihydroisochromene-7-carbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 102228350 |
| Molecular Formula | C27H30ClNO11 |
| Molecular Weight | 579.99 g/mol |
| Exact Mass | 579.15 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl (2S)-2-[[(3R)-5-chloro-8-hydroxy-3-methyl-1-oxo-3,4-dihydroisochromene-7-carbonyl]amino]-3-phenylpropanoate |
| SMILES | CO[C@H]1O[C@H](COC(=O)[C@H](Cc2ccccc2)NC(=O)c2cc(Cl)c3c(c2O)C(=O)O[C@H](C)C3)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H30ClNO11/c1-12-8-14-16(28)10-15(20(30)19(14)26(36)39-12)24(34)29-17(9-13-6-4-3-5-7-13)25(35)38-11-18-21(31)22(32)23(33)27(37-2)40-18/h3-7,10,12,17-18,21-23,27,30-33H,8-9,11H2,1-2H3,(H,29,34)/t12-,17+,18-,21-,22+,23-,27+/m1/s1 |
| InChIKey | DCEQSQHBADGIEV-TUDQHQDQSA-N |
| XLogP | 0.49 |
| TPSA | 181.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.99 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |