C26H28ClNO11 — CID 102228351
[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl (2S)-2-[[(3R)-5-chloro-8-hydroxy-3-methyl-1-oxo-3,4-dihydroisochromene-7-carbonyl]amino]-3-phenylpropanoate (PubChem CID 102228351) has the molecular formula C26H28ClNO11 and a molecular weight of 565.96 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl (2S)-2-[[(3R)-5-chloro-8-hydroxy-3-methyl-1-oxo-3,4-dihydroisochromene-7-carbonyl]amino]-3-phenylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl (2S)-2-[[(3R)-5-chloro-8-hydroxy-3-methyl-1-oxo-3,4-dihydroisochromene-7-carbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 102228351 |
| Molecular Formula | C26H28ClNO11 |
| Molecular Weight | 565.96 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl (2S)-2-[[(3R)-5-chloro-8-hydroxy-3-methyl-1-oxo-3,4-dihydroisochromene-7-carbonyl]amino]-3-phenylpropanoate |
| SMILES | C[C@@H]1Cc2c(Cl)cc(C(=O)N[C@@H](Cc3ccccc3)C(=O)OC[C@H]3O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]3O)c(O)c2C(=O)O1 |
| InChI | InChI=1S/C26H28ClNO11/c1-11-7-13-15(27)9-14(19(29)18(13)25(35)38-11)23(33)28-16(8-12-5-3-2-4-6-12)24(34)37-10-17-20(30)21(31)22(32)26(36)39-17/h2-6,9,11,16-17,20-22,26,29-32,36H,7-8,10H2,1H3,(H,28,33)/t11-,16+,17-,20-,21+,22-,26-/m1/s1 |
| InChIKey | DXRPXWZLCKQVSA-NEKJUPSXSA-N |
| XLogP | -0.17 |
| TPSA | 192.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.96 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |