C24H56Si6 — CID 102231826
trimethyl-[2,3,5,6-tetraethyl-1,4,4-tris(trimethylsilyl)-1,4-disilin-1-yl]silane (PubChem CID 102231826) has the molecular formula C24H56Si6 and a molecular weight of 513.23 g/mol. Its IUPAC name is trimethyl-[2,3,5,6-tetraethyl-1,4,4-tris(trimethylsilyl)-1,4-disilin-1-yl]silane.
| Compound Name | trimethyl-[2,3,5,6-tetraethyl-1,4,4-tris(trimethylsilyl)-1,4-disilin-1-yl]silane |
|---|---|
| PubChem CID | 102231826 |
| Molecular Formula | C24H56Si6 |
| Molecular Weight | 513.23 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | trimethyl-[2,3,5,6-tetraethyl-1,4,4-tris(trimethylsilyl)-1,4-disilin-1-yl]silane |
| SMILES | CCC1=C(CC)[Si]([Si](C)(C)C)([Si](C)(C)C)C(CC)=C(CC)[Si]1([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C24H56Si6/c1-17-21-22(18-2)30(27(11,12)13,28(14,15)16)24(20-4)23(19-3)29(21,25(5,6)7)26(8,9)10/h17-20H2,1-16H3 |
| InChIKey | AWRKSXDKBQODQV-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.23 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|