C26H29BCl2O6 — CID 102231865
[(Z)-6-(4-chlorobenzoyl)oxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-3-enyl] 4-chlorobenzoate (PubChem CID 102231865) has the molecular formula C26H29BCl2O6 and a molecular weight of 519.23 g/mol. Its IUPAC name is [(Z)-6-(4-chlorobenzoyl)oxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-3-enyl] 4-chlorobenzoate.
| Compound Name | [(Z)-6-(4-chlorobenzoyl)oxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-3-enyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 102231865 |
| Molecular Formula | C26H29BCl2O6 |
| Molecular Weight | 519.23 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | [(Z)-6-(4-chlorobenzoyl)oxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-3-enyl] 4-chlorobenzoate |
| SMILES | CC1(C)OB(/C(=C/CCOC(=O)c2ccc(Cl)cc2)CCOC(=O)c2ccc(Cl)cc2)OC1(C)C |
| InChI | InChI=1S/C26H29BCl2O6/c1-25(2)26(3,4)35-27(34-25)20(15-17-33-24(31)19-9-13-22(29)14-10-19)6-5-16-32-23(30)18-7-11-21(28)12-8-18/h6-14H,5,15-17H2,1-4H3/b20-6+ |
| InChIKey | LVLJHKVPKSVARY-CGOBSMCZSA-N |
| XLogP | 6.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.23 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|