C20H18F6N2O2S2 — CID 102233640
N,N'-bis[phenyl(trifluoromethyl)-λ4-sulfanylidene]hexanediamide (PubChem CID 102233640) has the molecular formula C20H18F6N2O2S2 and a molecular weight of 496.50 g/mol. Its IUPAC name is N,N'-bis[phenyl(trifluoromethyl)-λ4-sulfanylidene]hexanediamide.
| Compound Name | N,N'-bis[phenyl(trifluoromethyl)-λ4-sulfanylidene]hexanediamide |
|---|---|
| PubChem CID | 102233640 |
| Molecular Formula | C20H18F6N2O2S2 |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | N,N'-bis[phenyl(trifluoromethyl)-λ4-sulfanylidene]hexanediamide |
| SMILES | O=C(CCCCC(=O)/N=S(\c1ccccc1)C(F)(F)F)/N=S(/c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H18F6N2O2S2/c21-19(22,23)31(15-9-3-1-4-10-15)27-17(29)13-7-8-14-18(30)28-32(20(24,25)26)16-11-5-2-6-12-16/h1-6,9-12H,7-8,13-14H2 |
| InChIKey | GJTBQNLTWBIWCZ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|