C23H25NO — CID 102235879
(1S,16S,19R,21S)-8,16,20,20-tetramethyl-15-oxa-4-azahexacyclo[14.4.1.02,14.03,11.05,10.019,21]henicosa-2(14),3(11),5(10),6,8,12-hexaene (PubChem CID 102235879) has the molecular formula C23H25NO and a molecular weight of 331.46 g/mol. Its IUPAC name is (1S,16S,19R,21S)-8,16,20,20-tetramethyl-15-oxa-4-azahexacyclo[14.4.1.02,14.03,11.05,10.019,21]henicosa-2(14),3(11),5(10),6,8,12-hexaene.
| Compound Name | (1S,16S,19R,21S)-8,16,20,20-tetramethyl-15-oxa-4-azahexacyclo[14.4.1.02,14.03,11.05,10.019,21]henicosa-2(14),3(11),5(10),6,8,12-hexaene |
|---|---|
| PubChem CID | 102235879 |
| Molecular Formula | C23H25NO |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (1S,16S,19R,21S)-8,16,20,20-tetramethyl-15-oxa-4-azahexacyclo[14.4.1.02,14.03,11.05,10.019,21]henicosa-2(14),3(11),5(10),6,8,12-hexaene |
| SMILES | Cc1ccc2[nH]c3c4c(ccc3c2c1)O[C@@]1(C)CC[C@@H]2[C@H]1[C@H]4C2(C)C |
| InChI | InChI=1S/C23H25NO/c1-12-5-7-16-14(11-12)13-6-8-17-18(21(13)24-16)20-19-15(22(20,2)3)9-10-23(19,4)25-17/h5-8,11,15,19-20,24H,9-10H2,1-4H3/t15-,19+,20+,23+/m1/s1 |
| InChIKey | YNDNDGLKKJXJED-IVYXGSQZSA-N |
| XLogP | 5.93 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |