C18H22O4 — CID 54753488
(1S,9S,12R,14S)-5-hydroxy-3,9,13,13-tetramethyl-8-oxatetracyclo[7.4.1.02,7.012,14]tetradeca-2(7),3,5-triene-4-carboxylic acid (PubChem CID 54753488) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is (1S,9S,12R,14S)-5-hydroxy-3,9,13,13-tetramethyl-8-oxatetracyclo[7.4.1.02,7.012,14]tetradeca-2(7),3,5-triene-4-carboxylic acid.
| Compound Name | (1S,9S,12R,14S)-5-hydroxy-3,9,13,13-tetramethyl-8-oxatetracyclo[7.4.1.02,7.012,14]tetradeca-2(7),3,5-triene-4-carboxylic acid |
|---|---|
| PubChem CID | 54753488 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (1S,9S,12R,14S)-5-hydroxy-3,9,13,13-tetramethyl-8-oxatetracyclo[7.4.1.02,7.012,14]tetradeca-2(7),3,5-triene-4-carboxylic acid |
| SMILES | Cc1c(C(=O)O)c(O)cc2c1[C@H]1[C@@H]3[C@@H](CC[C@]3(C)O2)C1(C)C |
| InChI | InChI=1S/C18H22O4/c1-8-12(16(20)21)10(19)7-11-13(8)15-14-9(17(15,2)3)5-6-18(14,4)22-11/h7,9,14-15,19H,5-6H2,1-4H3,(H,20,21)/t9-,14+,15+,18+/m1/s1 |
| InChIKey | NRKQTNOYIVOQOH-RCDVYXTJSA-N |
| XLogP | 3.70 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |