C25H26O4 — CID 75593460
(1S,9S,12R,14S)-3-hydroxy-9,13,13-trimethyl-5-[(E)-2-phenylethenyl]-8-oxatetracyclo[7.4.1.02,7.012,14]tetradeca-2(7),3,5-triene-4-carboxylic acid (PubChem CID 75593460) has the molecular formula C25H26O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is (1S,9S,12R,14S)-3-hydroxy-9,13,13-trimethyl-5-[(E)-2-phenylethenyl]-8-oxatetracyclo[7.4.1.02,7.012,14]tetradeca-2(7),3,5-triene-4-carboxylic acid.
| Compound Name | (1S,9S,12R,14S)-3-hydroxy-9,13,13-trimethyl-5-[(E)-2-phenylethenyl]-8-oxatetracyclo[7.4.1.02,7.012,14]tetradeca-2(7),3,5-triene-4-carboxylic acid |
|---|---|
| PubChem CID | 75593460 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (1S,9S,12R,14S)-3-hydroxy-9,13,13-trimethyl-5-[(E)-2-phenylethenyl]-8-oxatetracyclo[7.4.1.02,7.012,14]tetradeca-2(7),3,5-triene-4-carboxylic acid |
| SMILES | CC1(C)[C@@H]2CC[C@]3(C)Oc4cc(/C=C/c5ccccc5)c(C(=O)O)c(O)c4[C@H]1[C@H]23 |
| InChI | InChI=1S/C25H26O4/c1-24(2)16-11-12-25(3)20(16)21(24)19-17(29-25)13-15(18(22(19)26)23(27)28)10-9-14-7-5-4-6-8-14/h4-10,13,16,20-21,26H,11-12H2,1-3H3,(H,27,28)/b10-9+/t16-,20+,21+,25+/m1/s1 |
| InChIKey | UOZHJIMMOVUGQW-LHOUJYSESA-N |
| XLogP | 5.56 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|