C24H28O2 — CID 162867057
(9S,12S,14R)-9,13,13-trimethyl-3-(2-phenylethyl)-8-oxatetracyclo[7.4.1.02,7.012,14]tetradeca-2,4,6-trien-5-ol (PubChem CID 162867057) has the molecular formula C24H28O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is (9S,12S,14R)-9,13,13-trimethyl-3-(2-phenylethyl)-8-oxatetracyclo[7.4.1.02,7.012,14]tetradeca-2,4,6-trien-5-ol.
| Compound Name | (9S,12S,14R)-9,13,13-trimethyl-3-(2-phenylethyl)-8-oxatetracyclo[7.4.1.02,7.012,14]tetradeca-2,4,6-trien-5-ol |
|---|---|
| PubChem CID | 162867057 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (9S,12S,14R)-9,13,13-trimethyl-3-(2-phenylethyl)-8-oxatetracyclo[7.4.1.02,7.012,14]tetradeca-2,4,6-trien-5-ol |
| SMILES | CC1(C)C2c3c(CCc4ccccc4)cc(O)cc3O[C@@]3(C)CC[C@H]1[C@H]23 |
| InChI | InChI=1S/C24H28O2/c1-23(2)18-11-12-24(3)21(18)22(23)20-16(13-17(25)14-19(20)26-24)10-9-15-7-5-4-6-8-15/h4-8,13-14,18,21-22,25H,9-12H2,1-3H3/t18-,21+,22?,24-/m0/s1 |
| InChIKey | HEHNRIJVSOOMII-ITFLQBOYSA-N |
| XLogP | 5.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |