C42H38NO2PS — CID 102236264
2-diphenylphosphanyl-N-[1,2-diphenyl-2-(2,4,5-trimethylphenyl)sulfinylethyl]benzamide (PubChem CID 102236264) has the molecular formula C42H38NO2PS and a molecular weight of 651.81 g/mol. Its IUPAC name is 2-diphenylphosphanyl-N-[1,2-diphenyl-2-(2,4,5-trimethylphenyl)sulfinylethyl]benzamide.
| Compound Name | 2-diphenylphosphanyl-N-[1,2-diphenyl-2-(2,4,5-trimethylphenyl)sulfinylethyl]benzamide |
|---|---|
| PubChem CID | 102236264 |
| Molecular Formula | C42H38NO2PS |
| Molecular Weight | 651.81 g/mol |
| Exact Mass | 651.24 |
| IUPAC Name | 2-diphenylphosphanyl-N-[1,2-diphenyl-2-(2,4,5-trimethylphenyl)sulfinylethyl]benzamide |
| SMILES | Cc1cc(C)c(S(=O)C(c2ccccc2)C(NC(=O)c2ccccc2P(c2ccccc2)c2ccccc2)c2ccccc2)cc1C |
| InChI | InChI=1S/C42H38NO2PS/c1-30-28-32(3)39(29-31(30)2)47(45)41(34-20-10-5-11-21-34)40(33-18-8-4-9-19-33)43-42(44)37-26-16-17-27-38(37)46(35-22-12-6-13-23-35)36-24-14-7-15-25-36/h4-29,40-41H,1-3H3,(H,43,44) |
| InChIKey | NHPIPYIEAGKWMV-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.81 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|