C50H44N2O2P2 — CID 102179617
2-diphenylphosphanyl-N-[(1S,2S)-1-[(2-diphenylphosphanylbenzoyl)amino]-6,7-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide (PubChem CID 102179617) has the molecular formula C50H44N2O2P2 and a molecular weight of 766.86 g/mol. Its IUPAC name is 2-diphenylphosphanyl-N-[(1S,2S)-1-[(2-diphenylphosphanylbenzoyl)amino]-6,7-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide.
| Compound Name | 2-diphenylphosphanyl-N-[(1S,2S)-1-[(2-diphenylphosphanylbenzoyl)amino]-6,7-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide |
|---|---|
| PubChem CID | 102179617 |
| Molecular Formula | C50H44N2O2P2 |
| Molecular Weight | 766.86 g/mol |
| Exact Mass | 766.29 |
| IUPAC Name | 2-diphenylphosphanyl-N-[(1S,2S)-1-[(2-diphenylphosphanylbenzoyl)amino]-6,7-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide |
| SMILES | Cc1cc2c(cc1C)[C@H](NC(=O)c1ccccc1P(c1ccccc1)c1ccccc1)[C@@H](NC(=O)c1ccccc1P(c1ccccc1)c1ccccc1)CC2 |
| InChI | InChI=1S/C50H44N2O2P2/c1-35-33-37-31-32-45(51-49(53)42-27-15-17-29-46(42)55(38-19-7-3-8-20-38)39-21-9-4-10-22-39)48(44(37)34-36(35)2)52-50(54)43-28-16-18-30-47(43)56(40-23-11-5-12-24-40)41-25-13-6-14-26-41/h3-30,33-34,45,48H,31-32H2,1-2H3,(H,51,53)(H,52,54)/t45-,48-/m0/s1 |
| InChIKey | RLRNCPSUWDAFSQ-PSCNNDFWSA-N |
| XLogP | 8.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.86 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|