C58H60N2O8P2 — CID 135084012
N-[(1R,2R)-2-[[2-bis[4-[3-(2-methoxyethoxymethoxy)prop-1-ynyl]phenyl]phosphanylbenzoyl]amino]cyclohexyl]-2-diphenylphosphanylbenzamide (PubChem CID 135084012) has the molecular formula C58H60N2O8P2 and a molecular weight of 975.07 g/mol. Its IUPAC name is N-[(1R,2R)-2-[[2-bis[4-[3-(2-methoxyethoxymethoxy)prop-1-ynyl]phenyl]phosphanylbenzoyl]amino]cyclohexyl]-2-diphenylphosphanylbenzamide.
| Compound Name | N-[(1R,2R)-2-[[2-bis[4-[3-(2-methoxyethoxymethoxy)prop-1-ynyl]phenyl]phosphanylbenzoyl]amino]cyclohexyl]-2-diphenylphosphanylbenzamide |
|---|---|
| PubChem CID | 135084012 |
| Molecular Formula | C58H60N2O8P2 |
| Molecular Weight | 975.07 g/mol |
| Exact Mass | 974.38 |
| IUPAC Name | N-[(1R,2R)-2-[[2-bis[4-[3-(2-methoxyethoxymethoxy)prop-1-ynyl]phenyl]phosphanylbenzoyl]amino]cyclohexyl]-2-diphenylphosphanylbenzamide |
| SMILES | COCCOCOCC#Cc1ccc(P(c2ccc(C#CCOCOCCOC)cc2)c2ccccc2C(=O)N[C@@H]2CCCC[C@H]2NC(=O)c2ccccc2P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C58H60N2O8P2/c1-63-39-41-67-43-65-37-15-17-45-29-33-49(34-30-45)70(50-35-31-46(32-36-50)18-16-38-66-44-68-42-40-64-2)56-28-14-10-24-52(56)58(62)60-54-26-12-11-25-53(54)59-57(61)51-23-9-13-27-55(51)69(47-19-5-3-6-20-47)48-21-7-4-8-22-48/h3-10,13-14,19-24,27-36,53-54H,11-12,25-26,37-44H2,1-2H3,(H,59,61)(H,60,62)/t53-,54-/m1/s1 |
| InChIKey | XOSQSXOTRFUJOY-RDTHBMROSA-N |
| XLogP | 6.65 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 975.07 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|