C44H44N2O2P2 — CID 155083999
2-diphenylphosphanyl-N-[(1R,2R)-2-[[[2-[[(3E)-hexa-1,3,5-trien-3-yl]-phenylphosphanyl]phenyl]-hydroxymethyl]amino]cyclohexyl]benzamide (PubChem CID 155083999) has the molecular formula C44H44N2O2P2 and a molecular weight of 694.80 g/mol. Its IUPAC name is 2-diphenylphosphanyl-N-[(1R,2R)-2-[[[2-[[(3E)-hexa-1,3,5-trien-3-yl]-phenylphosphanyl]phenyl]-hydroxymethyl]amino]cyclohexyl]benzamide.
| Compound Name | 2-diphenylphosphanyl-N-[(1R,2R)-2-[[[2-[[(3E)-hexa-1,3,5-trien-3-yl]-phenylphosphanyl]phenyl]-hydroxymethyl]amino]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 155083999 |
| Molecular Formula | C44H44N2O2P2 |
| Molecular Weight | 694.80 g/mol |
| Exact Mass | 694.29 |
| IUPAC Name | 2-diphenylphosphanyl-N-[(1R,2R)-2-[[[2-[[(3E)-hexa-1,3,5-trien-3-yl]-phenylphosphanyl]phenyl]-hydroxymethyl]amino]cyclohexyl]benzamide |
| SMILES | C=C/C=C(\C=C)P(c1ccccc1)c1ccccc1C(O)N[C@@H]1CCCC[C@H]1NC(=O)c1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H44N2O2P2/c1-3-20-33(4-2)49(34-21-8-5-9-22-34)41-31-18-14-27-37(41)43(47)45-39-29-16-17-30-40(39)46-44(48)38-28-15-19-32-42(38)50(35-23-10-6-11-24-35)36-25-12-7-13-26-36/h3-15,18-28,31-32,39-40,43,45,47H,1-2,16-17,29-30H2,(H,46,48)/b33-20+/t39-,40-,43?,49?/m1/s1 |
| InChIKey | MSNWRCJVWQJJEI-TWSXJMFMSA-N |
| XLogP | 7.46 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.80 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|