C25H25NO3S — CID 10223845
propyl (2S)-3,3-diphenyl-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 10223845) has the molecular formula C25H25NO3S and a molecular weight of 419.55 g/mol. Its IUPAC name is propyl (2S)-3,3-diphenyl-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | propyl (2S)-3,3-diphenyl-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 10223845 |
| Molecular Formula | C25H25NO3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | propyl (2S)-3,3-diphenyl-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | CCCOC(=O)[C@H]1N(C(=O)c2cccs2)CCC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25NO3S/c1-2-17-29-24(28)22-25(19-10-5-3-6-11-19,20-12-7-4-8-13-20)15-16-26(22)23(27)21-14-9-18-30-21/h3-14,18,22H,2,15-17H2,1H3/t22-/m1/s1 |
| InChIKey | WKPRRCGYYDMHHO-JOCHJYFZSA-N |
| XLogP | 4.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |