C41H46 — CID 102239530
(3R,5S,8S,9S,10S,13R,14S,16S)-10,13-dimethyl-3-naphthalen-2-yl-16-(4-phenylphenyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 102239530) has the molecular formula C41H46 and a molecular weight of 538.82 g/mol. Its IUPAC name is (3R,5S,8S,9S,10S,13R,14S,16S)-10,13-dimethyl-3-naphthalen-2-yl-16-(4-phenylphenyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3R,5S,8S,9S,10S,13R,14S,16S)-10,13-dimethyl-3-naphthalen-2-yl-16-(4-phenylphenyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 102239530 |
| Molecular Formula | C41H46 |
| Molecular Weight | 538.82 g/mol |
| Exact Mass | 538.36 |
| IUPAC Name | (3R,5S,8S,9S,10S,13R,14S,16S)-10,13-dimethyl-3-naphthalen-2-yl-16-(4-phenylphenyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@H]4C[C@H](c5ccc6ccccc6c5)CC[C@@]43C)[C@@H]1C[C@H](c1ccc(-c3ccccc3)cc1)C2 |
| InChI | InChI=1S/C41H46/c1-40-22-21-38-37(39(40)26-35(27-40)31-14-12-30(13-15-31)28-8-4-3-5-9-28)19-18-36-25-34(20-23-41(36,38)2)33-17-16-29-10-6-7-11-32(29)24-33/h3-17,24,34-39H,18-23,25-27H2,1-2H3/t34-,35+,36+,37-,38+,39+,40-,41+/m1/s1 |
| InChIKey | RHUQWZLIQOYOAD-FJOCRHSLSA-N |
| XLogP | 11.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.82 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |