C35H43FO3 — CID 164672422
methyl 2-[4-[4-[(3S,10S,13S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]phenyl]-3-fluorophenyl]propanoate (PubChem CID 164672422) has the molecular formula C35H43FO3 and a molecular weight of 530.72 g/mol. Its IUPAC name is methyl 2-[4-[4-[(3S,10S,13S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]phenyl]-3-fluorophenyl]propanoate.
| Compound Name | methyl 2-[4-[4-[(3S,10S,13S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]phenyl]-3-fluorophenyl]propanoate |
|---|---|
| PubChem CID | 164672422 |
| Molecular Formula | C35H43FO3 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.32 |
| IUPAC Name | methyl 2-[4-[4-[(3S,10S,13S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]phenyl]-3-fluorophenyl]propanoate |
| SMILES | COC(=O)C(C)c1ccc(-c2ccc([C@H]3CC[C@@]4(C)C(CCC5C4CC[C@]4(C)C(=O)CCC54)C3)cc2)c(F)c1 |
| InChI | InChI=1S/C35H43FO3/c1-21(33(38)39-4)24-9-11-27(31(36)20-24)23-7-5-22(6-8-23)25-15-17-34(2)26(19-25)10-12-28-29-13-14-32(37)35(29,3)18-16-30(28)34/h5-9,11,20-21,25-26,28-30H,10,12-19H2,1-4H3/t21?,25-,26?,28?,29?,30?,34-,35-/m0/s1 |
| InChIKey | YPYHSWSGCQXVMU-IXLIMNMZSA-N |
| XLogP | 8.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |