C22H36O9 — CID 102240987
(1R,23R)-25,26-dimethyl-3,6,9,12,15,18,21-heptaoxabicyclo[21.4.0]heptacos-25-ene-2,22-dione (PubChem CID 102240987) has the molecular formula C22H36O9 and a molecular weight of 444.52 g/mol. Its IUPAC name is (1R,23R)-25,26-dimethyl-3,6,9,12,15,18,21-heptaoxabicyclo[21.4.0]heptacos-25-ene-2,22-dione.
| Compound Name | (1R,23R)-25,26-dimethyl-3,6,9,12,15,18,21-heptaoxabicyclo[21.4.0]heptacos-25-ene-2,22-dione |
|---|---|
| PubChem CID | 102240987 |
| Molecular Formula | C22H36O9 |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | (1R,23R)-25,26-dimethyl-3,6,9,12,15,18,21-heptaoxabicyclo[21.4.0]heptacos-25-ene-2,22-dione |
| SMILES | CC1=C(C)C[C@H]2C(=O)OCCOCCOCCOCCOCCOCCOC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C22H36O9/c1-17-15-19-20(16-18(17)2)22(24)31-14-12-29-10-8-27-6-4-25-3-5-26-7-9-28-11-13-30-21(19)23/h19-20H,3-16H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | GWTJBKLPTFPWLO-WOJBJXKFSA-N |
| XLogP | 1.53 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|