C29H28N4O2 — CID 102246034
4-[(3aR,4S,8aR,8bS)-2-benzhydryl-1,3-dioxo-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-4-yl]benzenecarboximidamide (PubChem CID 102246034) has the molecular formula C29H28N4O2 and a molecular weight of 464.57 g/mol. Its IUPAC name is 4-[(3aR,4S,8aR,8bS)-2-benzhydryl-1,3-dioxo-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-4-yl]benzenecarboximidamide.
| Compound Name | 4-[(3aR,4S,8aR,8bS)-2-benzhydryl-1,3-dioxo-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-4-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 102246034 |
| Molecular Formula | C29H28N4O2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 4-[(3aR,4S,8aR,8bS)-2-benzhydryl-1,3-dioxo-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-4-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc([C@@H]2[C@@H]3C(=O)N(C(c4ccccc4)c4ccccc4)C(=O)[C@@H]3[C@H]3CCCN32)cc1 |
| InChI | InChI=1S/C29H28N4O2/c30-27(31)21-15-13-20(14-16-21)26-24-23(22-12-7-17-32(22)26)28(34)33(29(24)35)25(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-6,8-11,13-16,22-26H,7,12,17H2,(H3,30,31)/t22-,23-,24-,26-/m1/s1 |
| InChIKey | RJVQIEUJUDHSDT-PMHJDTQVSA-N |
| XLogP | 3.88 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|