C24H26N4O2 — CID 101055143
4-[(3aS,4R,9aS,9bR)-2-benzyl-1,3-dioxo-3a,4,6,7,8,9,9a,9b-octahydropyrrolo[3,4-a]indolizin-4-yl]benzenecarboximidamide (PubChem CID 101055143) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 4-[(3aS,4R,9aS,9bR)-2-benzyl-1,3-dioxo-3a,4,6,7,8,9,9a,9b-octahydropyrrolo[3,4-a]indolizin-4-yl]benzenecarboximidamide.
| Compound Name | 4-[(3aS,4R,9aS,9bR)-2-benzyl-1,3-dioxo-3a,4,6,7,8,9,9a,9b-octahydropyrrolo[3,4-a]indolizin-4-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 101055143 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 4-[(3aS,4R,9aS,9bR)-2-benzyl-1,3-dioxo-3a,4,6,7,8,9,9a,9b-octahydropyrrolo[3,4-a]indolizin-4-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc([C@H]2[C@H]3C(=O)N(Cc4ccccc4)C(=O)[C@H]3[C@@H]3CCCCN32)cc1 |
| InChI | InChI=1S/C24H26N4O2/c25-22(26)17-11-9-16(10-12-17)21-20-19(18-8-4-5-13-27(18)21)23(29)28(24(20)30)14-15-6-2-1-3-7-15/h1-3,6-7,9-12,18-21H,4-5,8,13-14H2,(H3,25,26)/t18-,19-,20-,21-/m0/s1 |
| InChIKey | RRQADSVCKOKFED-TUFLPTIASA-N |
| XLogP | 2.68 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|