C31H30N4O5 — CID 11203945
4-[(3aS,4R,7S,8aS,8bR)-2-(1,3-benzodioxol-5-ylmethyl)-1,3-dioxo-7-phenylmethoxy-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-4-yl]benzenecarboximidamide (PubChem CID 11203945) has the molecular formula C31H30N4O5 and a molecular weight of 538.60 g/mol. Its IUPAC name is 4-[(3aS,4R,7S,8aS,8bR)-2-(1,3-benzodioxol-5-ylmethyl)-1,3-dioxo-7-phenylmethoxy-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-4-yl]benzenecarboximidamide.
| Compound Name | 4-[(3aS,4R,7S,8aS,8bR)-2-(1,3-benzodioxol-5-ylmethyl)-1,3-dioxo-7-phenylmethoxy-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-4-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 11203945 |
| Molecular Formula | C31H30N4O5 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 4-[(3aS,4R,7S,8aS,8bR)-2-(1,3-benzodioxol-5-ylmethyl)-1,3-dioxo-7-phenylmethoxy-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-4-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc([C@H]2[C@H]3C(=O)N(Cc4ccc5c(c4)OCO5)C(=O)[C@H]3[C@@H]3C[C@H](OCc4ccccc4)CN32)cc1 |
| InChI | InChI=1S/C31H30N4O5/c32-29(33)21-9-7-20(8-10-21)28-27-26(23-13-22(15-34(23)28)38-16-18-4-2-1-3-5-18)30(36)35(31(27)37)14-19-6-11-24-25(12-19)40-17-39-24/h1-12,22-23,26-28H,13-17H2,(H3,32,33)/t22-,23-,26-,27-,28-/m0/s1 |
| InChIKey | YPIKLAOJRLMHPN-CINPPDSJSA-N |
| XLogP | 3.22 |
| TPSA | 118.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|