C23H25ClN4O3 — CID 22879036
4-[(3aR,4S,7S,8aR,8bS)-2-benzyl-7-hydroxy-1,3-dioxo-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-4-yl]benzenecarboximidamide;hydrochloride (PubChem CID 22879036) has the molecular formula C23H25ClN4O3 and a molecular weight of 440.93 g/mol. Its IUPAC name is 4-[(3aR,4S,7S,8aR,8bS)-2-benzyl-7-hydroxy-1,3-dioxo-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-4-yl]benzenecarboximidamide;hydrochloride.
| Compound Name | 4-[(3aR,4S,7S,8aR,8bS)-2-benzyl-7-hydroxy-1,3-dioxo-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-4-yl]benzenecarboximidamide;hydrochloride |
|---|---|
| PubChem CID | 22879036 |
| Molecular Formula | C23H25ClN4O3 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 4-[(3aR,4S,7S,8aR,8bS)-2-benzyl-7-hydroxy-1,3-dioxo-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizin-4-yl]benzenecarboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc([C@@H]2[C@@H]3C(=O)N(Cc4ccccc4)C(=O)[C@@H]3[C@H]3C[C@H](O)CN32)cc1 |
| InChI | InChI=1S/C23H24N4O3.ClH/c24-21(25)15-8-6-14(7-9-15)20-19-18(17-10-16(28)12-26(17)20)22(29)27(23(19)30)11-13-4-2-1-3-5-13;/h1-9,16-20,28H,10-12H2,(H3,24,25);1H/t16-,17+,18+,19+,20+;/m0./s1 |
| InChIKey | FEZRAHGGWOHQEX-USWONKHWSA-N |
| XLogP | 1.68 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|