C16H33NO2Si2 — CID 102246244
3-acetyl-1-[bis(trimethylsilyl)methyl]-4,4,5-trimethylpyrrolidin-2-one (PubChem CID 102246244) has the molecular formula C16H33NO2Si2 and a molecular weight of 327.62 g/mol. Its IUPAC name is 3-acetyl-1-[bis(trimethylsilyl)methyl]-4,4,5-trimethylpyrrolidin-2-one.
| Compound Name | 3-acetyl-1-[bis(trimethylsilyl)methyl]-4,4,5-trimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 102246244 |
| Molecular Formula | C16H33NO2Si2 |
| Molecular Weight | 327.62 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 3-acetyl-1-[bis(trimethylsilyl)methyl]-4,4,5-trimethylpyrrolidin-2-one |
| SMILES | CC(=O)C1C(=O)N(C([Si](C)(C)C)[Si](C)(C)C)C(C)C1(C)C |
| InChI | InChI=1S/C16H33NO2Si2/c1-11(18)13-14(19)17(12(2)16(13,3)4)15(20(5,6)7)21(8,9)10/h12-13,15H,1-10H3 |
| InChIKey | IIXLXNSAUDYJLS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.62 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|