C8H5N2O2- — CID 102246716
4-hydroxy-3H-pyrido[1,2-a]pyrimidin-3-id-2-one (PubChem CID 102246716) has the molecular formula C8H5N2O2- and a molecular weight of 161.14 g/mol. Its IUPAC name is 4-hydroxy-3H-pyrido[1,2-a]pyrimidin-3-id-2-one.
| Compound Name | 4-hydroxy-3H-pyrido[1,2-a]pyrimidin-3-id-2-one |
|---|---|
| PubChem CID | 102246716 |
| Molecular Formula | C8H5N2O2- |
| Molecular Weight | 161.14 g/mol |
| Exact Mass | 161.04 |
| IUPAC Name | 4-hydroxy-3H-pyrido[1,2-a]pyrimidin-3-id-2-one |
| SMILES | O=c1[c-]c(O)n2ccccc2n1 |
| InChI | InChI=1S/C8H5N2O2/c11-7-5-8(12)10-4-2-1-3-6(10)9-7/h1-4,12H/q-1 |
| InChIKey | QGIGTCAGFRFOHF-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.14 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|