C46H52O5S — CID 102250609
(2S,3S,4S,5R,6R)-2-[(3S)-3-methoxy-2-methyl-4-phenylbutan-2-yl]-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 102250609) has the molecular formula C46H52O5S and a molecular weight of 716.98 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-2-[(3S)-3-methoxy-2-methyl-4-phenylbutan-2-yl]-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,3S,4S,5R,6R)-2-[(3S)-3-methoxy-2-methyl-4-phenylbutan-2-yl]-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 102250609 |
| Molecular Formula | C46H52O5S |
| Molecular Weight | 716.98 g/mol |
| Exact Mass | 716.35 |
| IUPAC Name | (2S,3S,4S,5R,6R)-2-[(3S)-3-methoxy-2-methyl-4-phenylbutan-2-yl]-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | CO[C@@H](Cc1ccccc1)C(C)(C)[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C46H52O5S/c1-34-25-27-39(28-26-34)52-44-43(50-32-38-23-15-8-16-24-38)42(49-31-37-21-13-7-14-22-37)40(33-48-30-36-19-11-6-12-20-36)51-45(44)46(2,3)41(47-4)29-35-17-9-5-10-18-35/h5-28,40-45H,29-33H2,1-4H3/t40-,41+,42-,43+,44-,45-/m1/s1 |
| InChIKey | GBKILDUZFUEYAY-UPDCQTOWSA-N |
| XLogP | 9.89 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.98 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |