C39H45NO5S — CID 162653528
(2R,3S,4R,4aS,10bS)-9-tert-butyl-6-methylimino-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6-oxide (PubChem CID 162653528) has the molecular formula C39H45NO5S and a molecular weight of 639.86 g/mol. Its IUPAC name is (2R,3S,4R,4aS,10bS)-9-tert-butyl-6-methylimino-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6-oxide.
| Compound Name | (2R,3S,4R,4aS,10bS)-9-tert-butyl-6-methylimino-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6-oxide |
|---|---|
| PubChem CID | 162653528 |
| Molecular Formula | C39H45NO5S |
| Molecular Weight | 639.86 g/mol |
| Exact Mass | 639.30 |
| IUPAC Name | (2R,3S,4R,4aS,10bS)-9-tert-butyl-6-methylimino-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6-oxide |
| SMILES | CN=S1(=O)C[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)O[C@@H]2c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C39H45NO5S/c1-39(2,3)31-20-21-35-32(22-31)36-33(27-46(35,41)40-4)37(43-24-29-16-10-6-11-17-29)38(44-25-30-18-12-7-13-19-30)34(45-36)26-42-23-28-14-8-5-9-15-28/h5-22,33-34,36-38H,23-27H2,1-4H3/t33-,34+,36+,37+,38+,46?/m0/s1 |
| InChIKey | FUSITRZRELAMJJ-OWHXNTCTSA-N |
| XLogP | 7.90 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.86 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |