C29H43NO5Si — CID 102251470
(1S)-1-[(2S,3S,3aS,4S)-3-(hydroxymethyl)-4-[(2-methylpropan-2-yl)oxy]-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyethanol (PubChem CID 102251470) has the molecular formula C29H43NO5Si and a molecular weight of 513.75 g/mol. Its IUPAC name is (1S)-1-[(2S,3S,3aS,4S)-3-(hydroxymethyl)-4-[(2-methylpropan-2-yl)oxy]-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyethanol.
| Compound Name | (1S)-1-[(2S,3S,3aS,4S)-3-(hydroxymethyl)-4-[(2-methylpropan-2-yl)oxy]-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyethanol |
|---|---|
| PubChem CID | 102251470 |
| Molecular Formula | C29H43NO5Si |
| Molecular Weight | 513.75 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | (1S)-1-[(2S,3S,3aS,4S)-3-(hydroxymethyl)-4-[(2-methylpropan-2-yl)oxy]-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]-2-[tert-butyl(diphenyl)silyl]oxyethanol |
| SMILES | CC(C)(C)O[C@H]1CCN2O[C@H]([C@@H](O)CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H](CO)[C@@H]12 |
| InChI | InChI=1S/C29H43NO5Si/c1-28(2,3)34-25-17-18-30-26(25)23(19-31)27(35-30)24(32)20-33-36(29(4,5)6,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,23-27,31-32H,17-20H2,1-6H3/t23-,24+,25+,26+,27+/m1/s1 |
| InChIKey | WEJICZIDXGEVHY-YLSALNBJSA-N |
| XLogP | 3.10 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.75 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|