C24H43NO4Si2 — CID 11070649
(1S,2S,5R,6R,7R,8R)-5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-7-[dimethyl(phenyl)silyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,6-triol (PubChem CID 11070649) has the molecular formula C24H43NO4Si2 and a molecular weight of 465.78 g/mol. Its IUPAC name is (1S,2S,5R,6R,7R,8R)-5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-7-[dimethyl(phenyl)silyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,6-triol.
| Compound Name | (1S,2S,5R,6R,7R,8R)-5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-7-[dimethyl(phenyl)silyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,6-triol |
|---|---|
| PubChem CID | 11070649 |
| Molecular Formula | C24H43NO4Si2 |
| Molecular Weight | 465.78 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | (1S,2S,5R,6R,7R,8R)-5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-7-[dimethyl(phenyl)silyl]-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,6-triol |
| SMILES | CC(C)C(C)(C)[Si](C)(C)OC[C@@H]1[C@@H](O)[C@H]([Si](C)(C)c2ccccc2)[C@H]2[C@H](O)[C@@H](O)CN21 |
| InChI | InChI=1S/C24H43NO4Si2/c1-16(2)24(3,4)31(7,8)29-15-18-21(27)23(20-22(28)19(26)14-25(18)20)30(5,6)17-12-10-9-11-13-17/h9-13,16,18-23,26-28H,14-15H2,1-8H3/t18-,19+,20-,21-,22-,23-/m1/s1 |
| InChIKey | JCUJDNNEPACXJT-YPEXMJEGSA-N |
| XLogP | 2.78 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.78 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|